C6H3N9 — CID 102353617
[4-(cyanoamino)-6-(iminomethylideneamino)-1,3,5-triazin-2-yl]cyanamide (PubChem CID 102353617) has the molecular formula C6H3N9 and a molecular weight of 201.15 g/mol. Its IUPAC name is [4-(cyanoamino)-6-(iminomethylideneamino)-1,3,5-triazin-2-yl]cyanamide.
| Compound Name | [4-(cyanoamino)-6-(iminomethylideneamino)-1,3,5-triazin-2-yl]cyanamide |
|---|---|
| PubChem CID | 102353617 |
| Molecular Formula | C6H3N9 |
| Molecular Weight | 201.15 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | [4-(cyanoamino)-6-(iminomethylideneamino)-1,3,5-triazin-2-yl]cyanamide |
| SMILES | N#CNc1nc(N=C=N)nc(NC#N)n1 |
| InChI | InChI=1S/C6H3N9/c7-1-10-4-13-5(11-2-8)15-6(14-4)12-3-9/h7H,(H2,11,12,13,14,15) |
| InChIKey | GDWKMVGKXRUVAB-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 146.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.15 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|