C6H2N9- — CID 102353616
[4,6-bis(cyanoamino)-1,3,5-triazin-2-yl]iminomethylideneazanide (PubChem CID 102353616) has the molecular formula C6H2N9- and a molecular weight of 200.14 g/mol. Its IUPAC name is [4,6-bis(cyanoamino)-1,3,5-triazin-2-yl]iminomethylideneazanide.
| Compound Name | [4,6-bis(cyanoamino)-1,3,5-triazin-2-yl]iminomethylideneazanide |
|---|---|
| PubChem CID | 102353616 |
| Molecular Formula | C6H2N9- |
| Molecular Weight | 200.14 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | [4,6-bis(cyanoamino)-1,3,5-triazin-2-yl]iminomethylideneazanide |
| SMILES | N#CNc1nc(N=C=[N-])nc(NC#N)n1 |
| InChI | InChI=1S/C6H2N9/c7-1-10-4-13-5(11-2-8)15-6(14-4)12-3-9/h(H2,10,11,13,14,15)/q-1 |
| InChIKey | UQRRSFASCKTOFY-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 144.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.14 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|