C8H2F2N4O2 — CID 176532278
[2,5-difluoro-4-(iminomethylideneamino)-3,6-dioxocyclohexa-1,4-dien-1-yl]cyanamide (PubChem CID 176532278) has the molecular formula C8H2F2N4O2 and a molecular weight of 224.13 g/mol. Its IUPAC name is [2,5-difluoro-4-(iminomethylideneamino)-3,6-dioxocyclohexa-1,4-dien-1-yl]cyanamide.
| Compound Name | [2,5-difluoro-4-(iminomethylideneamino)-3,6-dioxocyclohexa-1,4-dien-1-yl]cyanamide |
|---|---|
| PubChem CID | 176532278 |
| Molecular Formula | C8H2F2N4O2 |
| Molecular Weight | 224.13 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | [2,5-difluoro-4-(iminomethylideneamino)-3,6-dioxocyclohexa-1,4-dien-1-yl]cyanamide |
| SMILES | N#CNC1=C(F)C(=O)C(N=C=N)=C(F)C1=O |
| InChI | InChI=1S/C8H2F2N4O2/c9-3-5(13-1-11)7(15)4(10)6(8(3)16)14-2-12/h11,14H |
| InChIKey | VDSGYCRJODQPAL-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 106.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.13 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|