About 5,6-diamino-2,4-dimethylpyridine-3-carbonitrile
5,6-diamino-2,4-dimethylpyridine-3-carbonitrile (PubChem CID 54463519) has the molecular formula C8H10N4
and a molecular weight of 162.20 g/mol. Its IUPAC name is 5,6-diamino-2,4-dimethylpyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 5,6-diamino-2,4-dimethylpyridine-3-carbonitrile |
| PubChem CID | 54463519 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 5,6-diamino-2,4-dimethylpyridine-3-carbonitrile |
| SMILES | Cc1nc(N)c(N)c(C)c1C#N |
| InChI | InChI=1S/C8H10N4/c1-4-6(3-9)5(2)12-8(11)7(4)10/h10H2,1-2H3,(H2,11,12) |
| InChIKey | XDGKVHRTHRLPCF-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 88.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,6-diamino-2,4-dimethylpyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-diamino-2,4-dimethylpyridine-3-carbonitrile?
The IUPAC name of 5,6-diamino-2,4-dimethylpyridine-3-carbonitrile (CID 54463519) is 5,6-diamino-2,4-dimethylpyridine-3-carbonitrile.
What is the SMILES notation for 5,6-diamino-2,4-dimethylpyridine-3-carbonitrile?
The canonical SMILES for 5,6-diamino-2,4-dimethylpyridine-3-carbonitrile is Cc1nc(N)c(N)c(C)c1C#N.
What is the InChIKey of 5,6-diamino-2,4-dimethylpyridine-3-carbonitrile?
The InChIKey is XDGKVHRTHRLPCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4/c1-4-6(3-9)5(2)12-8(11)7(4)10/h10H2,1-2H3,(H2,11,12).
What are the key properties of 5,6-diamino-2,4-dimethylpyridine-3-carbonitrile?
5,6-diamino-2,4-dimethylpyridine-3-carbonitrile has a molecular weight of 162.20 g/mol, XLogP of 0.73, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-diamino-2,4-dimethylpyridine-3-carbonitrile is sourced from PubChem (CID 54463519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).