C8H10N4 — CID 54463519
5,6-diamino-2,4-dimethylpyridine-3-carbonitrile (PubChem CID 54463519) has the molecular formula C8H10N4 and a molecular weight of 162.20 g/mol. Its IUPAC name is 5,6-diamino-2,4-dimethylpyridine-3-carbonitrile.
| Compound Name | 5,6-diamino-2,4-dimethylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 54463519 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 5,6-diamino-2,4-dimethylpyridine-3-carbonitrile |
| SMILES | Cc1nc(N)c(N)c(C)c1C#N |
| InChI | InChI=1S/C8H10N4/c1-4-6(3-9)5(2)12-8(11)7(4)10/h10H2,1-2H3,(H2,11,12) |
| InChIKey | XDGKVHRTHRLPCF-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 88.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |