C14H23N9S2 — CID 126730838
6-ethylsulfanyl-2-N-[2-[(4-ethylsulfanyl-6-methyl-1,3,5-triazin-2-yl)amino]ethyl]-4-N-methyl-1,3,5-triazine-2,4-diamine (PubChem CID 126730838) has the molecular formula C14H23N9S2 and a molecular weight of 381.54 g/mol. Its IUPAC name is 6-ethylsulfanyl-2-N-[2-[(4-ethylsulfanyl-6-methyl-1,3,5-triazin-2-yl)amino]ethyl]-4-N-methyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-ethylsulfanyl-2-N-[2-[(4-ethylsulfanyl-6-methyl-1,3,5-triazin-2-yl)amino]ethyl]-4-N-methyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 126730838 |
| Molecular Formula | C14H23N9S2 |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 6-ethylsulfanyl-2-N-[2-[(4-ethylsulfanyl-6-methyl-1,3,5-triazin-2-yl)amino]ethyl]-4-N-methyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCSc1nc(C)nc(NCCNc2nc(NC)nc(SCC)n2)n1 |
| InChI | InChI=1S/C14H23N9S2/c1-5-24-13-19-9(3)18-11(22-13)16-7-8-17-12-20-10(15-4)21-14(23-12)25-6-2/h5-8H2,1-4H3,(H,16,18,19,22)(H2,15,17,20,21,23) |
| InChIKey | RRZLESCRFRQTHZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 113.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|