C27H34F2N4S2 — CID 635746
4,6-bis[(4-fluorophenyl)sulfanyl]-N,N-dihexyl-1,3,5-triazin-2-amine (PubChem CID 635746) has the molecular formula C27H34F2N4S2 and a molecular weight of 516.73 g/mol. Its IUPAC name is 4,6-bis[(4-fluorophenyl)sulfanyl]-N,N-dihexyl-1,3,5-triazin-2-amine.
| Compound Name | 4,6-bis[(4-fluorophenyl)sulfanyl]-N,N-dihexyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 635746 |
| Molecular Formula | C27H34F2N4S2 |
| Molecular Weight | 516.73 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | 4,6-bis[(4-fluorophenyl)sulfanyl]-N,N-dihexyl-1,3,5-triazin-2-amine |
| SMILES | CCCCCCN(CCCCCC)c1nc(Sc2ccc(F)cc2)nc(Sc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C27H34F2N4S2/c1-3-5-7-9-19-33(20-10-8-6-4-2)25-30-26(34-23-15-11-21(28)12-16-23)32-27(31-25)35-24-17-13-22(29)14-18-24/h11-18H,3-10,19-20H2,1-2H3 |
| InChIKey | ZEWXVVJTLZYWCQ-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.73 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|