C8H14ClN5 — CID 169436041
6-chloro-4-N-methyl-2-N,2-N-bis(1,1,2,2,2-pentadeuterioethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 169436041) has the molecular formula C8H14ClN5 and a molecular weight of 225.75 g/mol. Its IUPAC name is 6-chloro-4-N-methyl-2-N,2-N-bis(1,1,2,2,2-pentadeuterioethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-4-N-methyl-2-N,2-N-bis(1,1,2,2,2-pentadeuterioethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 169436041 |
| Molecular Formula | C8H14ClN5 |
| Molecular Weight | 225.75 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | 6-chloro-4-N-methyl-2-N,2-N-bis(1,1,2,2,2-pentadeuterioethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N(c1nc(Cl)nc(NC)n1)C([2H])([2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C8H14ClN5/c1-4-14(5-2)8-12-6(9)11-7(10-3)13-8/h4-5H2,1-3H3,(H,10,11,12,13)/i1D3,2D3,4D2,5D2 |
| InChIKey | JTOXFTHSONSSIJ-IZUSZFKNSA-N |
| XLogP | 1.41 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.75 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |