C8H8ClN7 — CID 80754360
2-[[4-chloro-6-(methylamino)-1,3,5-triazin-2-yl]-(cyanomethyl)amino]acetonitrile (PubChem CID 80754360) has the molecular formula C8H8ClN7 and a molecular weight of 237.65 g/mol. Its IUPAC name is 2-[[4-chloro-6-(methylamino)-1,3,5-triazin-2-yl]-(cyanomethyl)amino]acetonitrile.
| Compound Name | 2-[[4-chloro-6-(methylamino)-1,3,5-triazin-2-yl]-(cyanomethyl)amino]acetonitrile |
|---|---|
| PubChem CID | 80754360 |
| Molecular Formula | C8H8ClN7 |
| Molecular Weight | 237.65 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 2-[[4-chloro-6-(methylamino)-1,3,5-triazin-2-yl]-(cyanomethyl)amino]acetonitrile |
| SMILES | CNc1nc(Cl)nc(N(CC#N)CC#N)n1 |
| InChI | InChI=1S/C8H8ClN7/c1-12-7-13-6(9)14-8(15-7)16(4-2-10)5-3-11/h4-5H2,1H3,(H,12,13,14,15) |
| InChIKey | JSEOZXFAWSKPNK-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 101.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.65 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|