C13H18N8 — CID 80757445
2-[cyanomethyl-[4-(methylamino)-6-piperidin-1-yl-1,3,5-triazin-2-yl]amino]acetonitrile (PubChem CID 80757445) has the molecular formula C13H18N8 and a molecular weight of 286.34 g/mol. Its IUPAC name is 2-[cyanomethyl-[4-(methylamino)-6-piperidin-1-yl-1,3,5-triazin-2-yl]amino]acetonitrile.
| Compound Name | 2-[cyanomethyl-[4-(methylamino)-6-piperidin-1-yl-1,3,5-triazin-2-yl]amino]acetonitrile |
|---|---|
| PubChem CID | 80757445 |
| Molecular Formula | C13H18N8 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 2-[cyanomethyl-[4-(methylamino)-6-piperidin-1-yl-1,3,5-triazin-2-yl]amino]acetonitrile |
| SMILES | CNc1nc(N(CC#N)CC#N)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C13H18N8/c1-16-11-17-12(20-7-3-2-4-8-20)19-13(18-11)21(9-5-14)10-6-15/h2-4,7-10H2,1H3,(H,16,17,18,19) |
| InChIKey | XLFRYPDLJCYGCO-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|