C12H16N8 — CID 80753881
2-[(4-amino-6-piperidin-1-yl-1,3,5-triazin-2-yl)-(cyanomethyl)amino]acetonitrile (PubChem CID 80753881) has the molecular formula C12H16N8 and a molecular weight of 272.32 g/mol. Its IUPAC name is 2-[(4-amino-6-piperidin-1-yl-1,3,5-triazin-2-yl)-(cyanomethyl)amino]acetonitrile.
| Compound Name | 2-[(4-amino-6-piperidin-1-yl-1,3,5-triazin-2-yl)-(cyanomethyl)amino]acetonitrile |
|---|---|
| PubChem CID | 80753881 |
| Molecular Formula | C12H16N8 |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 2-[(4-amino-6-piperidin-1-yl-1,3,5-triazin-2-yl)-(cyanomethyl)amino]acetonitrile |
| SMILES | N#CCN(CC#N)c1nc(N)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C12H16N8/c13-4-8-20(9-5-14)12-17-10(15)16-11(18-12)19-6-2-1-3-7-19/h1-3,6-9H2,(H2,15,16,17,18) |
| InChIKey | HNERJVOFIPWZBY-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 118.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|