C10H13N7O — CID 80753645
2-[cyanomethyl-[4-ethoxy-6-(methylamino)-1,3,5-triazin-2-yl]amino]acetonitrile (PubChem CID 80753645) has the molecular formula C10H13N7O and a molecular weight of 247.26 g/mol. Its IUPAC name is 2-[cyanomethyl-[4-ethoxy-6-(methylamino)-1,3,5-triazin-2-yl]amino]acetonitrile.
| Compound Name | 2-[cyanomethyl-[4-ethoxy-6-(methylamino)-1,3,5-triazin-2-yl]amino]acetonitrile |
|---|---|
| PubChem CID | 80753645 |
| Molecular Formula | C10H13N7O |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 2-[cyanomethyl-[4-ethoxy-6-(methylamino)-1,3,5-triazin-2-yl]amino]acetonitrile |
| SMILES | CCOc1nc(NC)nc(N(CC#N)CC#N)n1 |
| InChI | InChI=1S/C10H13N7O/c1-3-18-10-15-8(13-2)14-9(16-10)17(6-4-11)7-5-12/h3,6-7H2,1-2H3,(H,13,14,15,16) |
| InChIKey | JLJJHYSWUHHDBM-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|