C23H44ClN5O4 — CID 139712262
2-N,2-N,4-N,4-N-tetrakis(butoxymethyl)-6-chloro-1,3,5-triazine-2,4-diamine (PubChem CID 139712262) has the molecular formula C23H44ClN5O4 and a molecular weight of 490.09 g/mol. Its IUPAC name is 2-N,2-N,4-N,4-N-tetrakis(butoxymethyl)-6-chloro-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N,4-N,4-N-tetrakis(butoxymethyl)-6-chloro-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 139712262 |
| Molecular Formula | C23H44ClN5O4 |
| Molecular Weight | 490.09 g/mol |
| Exact Mass | 489.31 |
| IUPAC Name | 2-N,2-N,4-N,4-N-tetrakis(butoxymethyl)-6-chloro-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCOCN(COCCCC)c1nc(Cl)nc(N(COCCCC)COCCCC)n1 |
| InChI | InChI=1S/C23H44ClN5O4/c1-5-9-13-30-17-28(18-31-14-10-6-2)22-25-21(24)26-23(27-22)29(19-32-15-11-7-3)20-33-16-12-8-4/h5-20H2,1-4H3 |
| InChIKey | BUOWDKRTWUOHRA-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 82.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.09 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|