C25H49N5O4 — CID 67518532
1-[[4-[bis(butoxymethyl)amino]-6-ethyl-1,3,5-triazin-2-yl]-(butoxymethyl)amino]pentan-1-ol (PubChem CID 67518532) has the molecular formula C25H49N5O4 and a molecular weight of 483.70 g/mol. Its IUPAC name is 1-[[4-[bis(butoxymethyl)amino]-6-ethyl-1,3,5-triazin-2-yl]-(butoxymethyl)amino]pentan-1-ol.
| Compound Name | 1-[[4-[bis(butoxymethyl)amino]-6-ethyl-1,3,5-triazin-2-yl]-(butoxymethyl)amino]pentan-1-ol |
|---|---|
| PubChem CID | 67518532 |
| Molecular Formula | C25H49N5O4 |
| Molecular Weight | 483.70 g/mol |
| Exact Mass | 483.38 |
| IUPAC Name | 1-[[4-[bis(butoxymethyl)amino]-6-ethyl-1,3,5-triazin-2-yl]-(butoxymethyl)amino]pentan-1-ol |
| SMILES | CCCCOCN(COCCCC)c1nc(CC)nc(N(COCCCC)C(O)CCCC)n1 |
| InChI | InChI=1S/C25H49N5O4/c1-6-11-15-23(31)30(21-34-18-14-9-4)25-27-22(10-5)26-24(28-25)29(19-32-16-12-7-2)20-33-17-13-8-3/h23,31H,6-21H2,1-5H3 |
| InChIKey | YUSBAANSYLRLLQ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 93.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.70 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|