C19H29N5O3 — CID 89467737
1-[[4-[butoxymethyl(methoxymethyl)amino]-6-(3-methylphenyl)-1,3,5-triazin-2-yl]amino]ethanol (PubChem CID 89467737) has the molecular formula C19H29N5O3 and a molecular weight of 375.47 g/mol. Its IUPAC name is 1-[[4-[butoxymethyl(methoxymethyl)amino]-6-(3-methylphenyl)-1,3,5-triazin-2-yl]amino]ethanol.
| Compound Name | 1-[[4-[butoxymethyl(methoxymethyl)amino]-6-(3-methylphenyl)-1,3,5-triazin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 89467737 |
| Molecular Formula | C19H29N5O3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 1-[[4-[butoxymethyl(methoxymethyl)amino]-6-(3-methylphenyl)-1,3,5-triazin-2-yl]amino]ethanol |
| SMILES | CCCCOCN(COC)c1nc(NC(C)O)nc(-c2cccc(C)c2)n1 |
| InChI | InChI=1S/C19H29N5O3/c1-5-6-10-27-13-24(12-26-4)19-22-17(16-9-7-8-14(2)11-16)21-18(23-19)20-15(3)25/h7-9,11,15,25H,5-6,10,12-13H2,1-4H3,(H,20,21,22,23) |
| InChIKey | CYBKSVKPFDVHHN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 92.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|