C20H40N6O4 — CID 20676471
2-N,4-N-bis(butoxymethyl)-6-N-ethyl-2-N,4-N-bis(methoxymethyl)-6-N-methyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 20676471) has the molecular formula C20H40N6O4 and a molecular weight of 428.58 g/mol. Its IUPAC name is 2-N,4-N-bis(butoxymethyl)-6-N-ethyl-2-N,4-N-bis(methoxymethyl)-6-N-methyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N-bis(butoxymethyl)-6-N-ethyl-2-N,4-N-bis(methoxymethyl)-6-N-methyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 20676471 |
| Molecular Formula | C20H40N6O4 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.31 |
| IUPAC Name | 2-N,4-N-bis(butoxymethyl)-6-N-ethyl-2-N,4-N-bis(methoxymethyl)-6-N-methyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCOCN(COC)c1nc(N(C)CC)nc(N(COC)COCCCC)n1 |
| InChI | InChI=1S/C20H40N6O4/c1-7-10-12-29-16-25(14-27-5)19-21-18(24(4)9-3)22-20(23-19)26(15-28-6)17-30-13-11-8-2/h7-17H2,1-6H3 |
| InChIKey | HEXHOZGKAWKKER-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 85.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|