C29H55N5O4 — CID 70842070
1-[[4-[bis(butoxymethyl)amino]-6-cyclohexyl-1,3,5-triazin-2-yl]-(butoxymethyl)amino]pentan-1-ol (PubChem CID 70842070) has the molecular formula C29H55N5O4 and a molecular weight of 537.79 g/mol. Its IUPAC name is 1-[[4-[bis(butoxymethyl)amino]-6-cyclohexyl-1,3,5-triazin-2-yl]-(butoxymethyl)amino]pentan-1-ol.
| Compound Name | 1-[[4-[bis(butoxymethyl)amino]-6-cyclohexyl-1,3,5-triazin-2-yl]-(butoxymethyl)amino]pentan-1-ol |
|---|---|
| PubChem CID | 70842070 |
| Molecular Formula | C29H55N5O4 |
| Molecular Weight | 537.79 g/mol |
| Exact Mass | 537.43 |
| IUPAC Name | 1-[[4-[bis(butoxymethyl)amino]-6-cyclohexyl-1,3,5-triazin-2-yl]-(butoxymethyl)amino]pentan-1-ol |
| SMILES | CCCCOCN(COCCCC)c1nc(C2CCCCC2)nc(N(COCCCC)C(O)CCCC)n1 |
| InChI | InChI=1S/C29H55N5O4/c1-5-9-18-26(35)34(24-38-21-12-8-4)29-31-27(25-16-14-13-15-17-25)30-28(32-29)33(22-36-19-10-6-2)23-37-20-11-7-3/h25-26,35H,5-24H2,1-4H3 |
| InChIKey | WOKMAERMXGXPFX-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 93.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.79 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|