C21H39N5O3 — CID 58341523
2-N,4-N-bis(butoxymethyl)-6-cyclopentyl-2-N-(methoxymethyl)-4-N-methyl-1,3,5-triazine-2,4-diamine (PubChem CID 58341523) has the molecular formula C21H39N5O3 and a molecular weight of 409.58 g/mol. Its IUPAC name is 2-N,4-N-bis(butoxymethyl)-6-cyclopentyl-2-N-(methoxymethyl)-4-N-methyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-bis(butoxymethyl)-6-cyclopentyl-2-N-(methoxymethyl)-4-N-methyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 58341523 |
| Molecular Formula | C21H39N5O3 |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.31 |
| IUPAC Name | 2-N,4-N-bis(butoxymethyl)-6-cyclopentyl-2-N-(methoxymethyl)-4-N-methyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCOCN(C)c1nc(C2CCCC2)nc(N(COC)COCCCC)n1 |
| InChI | InChI=1S/C21H39N5O3/c1-5-7-13-28-15-25(3)20-22-19(18-11-9-10-12-18)23-21(24-20)26(16-27-4)17-29-14-8-6-2/h18H,5-17H2,1-4H3 |
| InChIKey | KPEGLIIHTCUZCC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 72.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|