C19H34N4O2 — CID 58341520
N-(butoxymethyl)-4-ethyl-N-(methoxymethyl)-6-(4-methylcyclohexyl)-1,3,5-triazin-2-amine (PubChem CID 58341520) has the molecular formula C19H34N4O2 and a molecular weight of 350.51 g/mol. Its IUPAC name is N-(butoxymethyl)-4-ethyl-N-(methoxymethyl)-6-(4-methylcyclohexyl)-1,3,5-triazin-2-amine.
| Compound Name | N-(butoxymethyl)-4-ethyl-N-(methoxymethyl)-6-(4-methylcyclohexyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 58341520 |
| Molecular Formula | C19H34N4O2 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.27 |
| IUPAC Name | N-(butoxymethyl)-4-ethyl-N-(methoxymethyl)-6-(4-methylcyclohexyl)-1,3,5-triazin-2-amine |
| SMILES | CCCCOCN(COC)c1nc(CC)nc(C2CCC(C)CC2)n1 |
| InChI | InChI=1S/C19H34N4O2/c1-5-7-12-25-14-23(13-24-4)19-21-17(6-2)20-18(22-19)16-10-8-15(3)9-11-16/h15-16H,5-14H2,1-4H3 |
| InChIKey | ZJGBAMOAOBXKFR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|