C13H26N6O5 — CID 58463192
N-[2-[4,6-bis[bis(methoxymethyl)amino]-1,3,5-triazin-2-yl]ethyl]hydroxylamine (PubChem CID 58463192) has the molecular formula C13H26N6O5 and a molecular weight of 346.39 g/mol. Its IUPAC name is N-[2-[4,6-bis[bis(methoxymethyl)amino]-1,3,5-triazin-2-yl]ethyl]hydroxylamine.
| Compound Name | N-[2-[4,6-bis[bis(methoxymethyl)amino]-1,3,5-triazin-2-yl]ethyl]hydroxylamine |
|---|---|
| PubChem CID | 58463192 |
| Molecular Formula | C13H26N6O5 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | N-[2-[4,6-bis[bis(methoxymethyl)amino]-1,3,5-triazin-2-yl]ethyl]hydroxylamine |
| SMILES | COCN(COC)c1nc(CCNO)nc(N(COC)COC)n1 |
| InChI | InChI=1S/C13H26N6O5/c1-21-7-18(8-22-2)12-15-11(5-6-14-20)16-13(17-12)19(9-23-3)10-24-4/h14,20H,5-10H2,1-4H3 |
| InChIKey | OQYBTVDHSJTLLC-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 114.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|