C15H30N6O6 — CID 70903216
6-[1-(aminomethoxy)-2-methoxyethyl]-2-N,2-N,4-N,4-N-tetrakis(methoxymethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 70903216) has the molecular formula C15H30N6O6 and a molecular weight of 390.44 g/mol. Its IUPAC name is 6-[1-(aminomethoxy)-2-methoxyethyl]-2-N,2-N,4-N,4-N-tetrakis(methoxymethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[1-(aminomethoxy)-2-methoxyethyl]-2-N,2-N,4-N,4-N-tetrakis(methoxymethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 70903216 |
| Molecular Formula | C15H30N6O6 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 6-[1-(aminomethoxy)-2-methoxyethyl]-2-N,2-N,4-N,4-N-tetrakis(methoxymethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | COCC(OCN)c1nc(N(COC)COC)nc(N(COC)COC)n1 |
| InChI | InChI=1S/C15H30N6O6/c1-22-6-12(27-7-16)13-17-14(20(8-23-2)9-24-3)19-15(18-13)21(10-25-4)11-26-5/h12H,6-11,16H2,1-5H3 |
| InChIKey | CCIRVDUKZXVOTF-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 126.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|