C21H30N6O9 — CID 132518202
[[4,6-bis[methoxymethyl(prop-2-enoyloxymethyl)amino]-1,3,5-triazin-2-yl]-(methoxymethyl)amino]methyl prop-2-enoate (PubChem CID 132518202) has the molecular formula C21H30N6O9 and a molecular weight of 510.50 g/mol. Its IUPAC name is [[4,6-bis[methoxymethyl(prop-2-enoyloxymethyl)amino]-1,3,5-triazin-2-yl]-(methoxymethyl)amino]methyl prop-2-enoate.
| Compound Name | [[4,6-bis[methoxymethyl(prop-2-enoyloxymethyl)amino]-1,3,5-triazin-2-yl]-(methoxymethyl)amino]methyl prop-2-enoate |
|---|---|
| PubChem CID | 132518202 |
| Molecular Formula | C21H30N6O9 |
| Molecular Weight | 510.50 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | [[4,6-bis[methoxymethyl(prop-2-enoyloxymethyl)amino]-1,3,5-triazin-2-yl]-(methoxymethyl)amino]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCN(COC)c1nc(N(COC)COC(=O)C=C)nc(N(COC)COC(=O)C=C)n1 |
| InChI | InChI=1S/C21H30N6O9/c1-7-16(28)34-13-25(10-31-4)19-22-20(26(11-32-5)14-35-17(29)8-2)24-21(23-19)27(12-33-6)15-36-18(30)9-3/h7-9H,1-3,10-15H2,4-6H3 |
| InChIKey | ZLFSQJYAPFUXJI-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 154.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.50 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|