C17H32N6O8 — CID 67920116
2,2,2-trimethoxyethyl prop-2-enoate;2-N,2-N,4-N-tris(methoxymethyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 67920116) has the molecular formula C17H32N6O8 and a molecular weight of 448.48 g/mol. Its IUPAC name is 2,2,2-trimethoxyethyl prop-2-enoate;2-N,2-N,4-N-tris(methoxymethyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2,2,2-trimethoxyethyl prop-2-enoate;2-N,2-N,4-N-tris(methoxymethyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 67920116 |
| Molecular Formula | C17H32N6O8 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 2,2,2-trimethoxyethyl prop-2-enoate;2-N,2-N,4-N-tris(methoxymethyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | C=CC(=O)OCC(OC)(OC)OC.COCNc1nc(N)nc(N(COC)COC)n1 |
| InChI | InChI=1S/C9H18N6O3.C8H14O5/c1-16-4-11-8-12-7(10)13-9(14-8)15(5-17-2)6-18-3;1-5-7(9)13-6-8(10-2,11-3)12-4/h4-6H2,1-3H3,(H3,10,11,12,13,14);5H,1,6H2,2-4H3 |
| InChIKey | FKJZYLAVRRRHBH-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 161.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|