C9H16N6O3 — CID 58779906
CID 58779906 (PubChem CID 58779906) has the molecular formula C9H16N6O3 and a molecular weight of 256.27 g/mol.
| Compound Name | CID 58779906 |
|---|---|
| PubChem CID | 58779906 |
| Molecular Formula | C9H16N6O3 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | — |
| SMILES | [CH]N(OC)c1nc(NCOC)nc(NCOC)n1 |
| InChI | InChI=1S/C9H16N6O3/c1-15(18-4)9-13-7(10-5-16-2)12-8(14-9)11-6-17-3/h1H,5-6H2,2-4H3,(H2,10,11,12,13,14) |
| InChIKey | OBVMMXGGAFNVAY-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 93.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|