C8H15N5O2 — CID 89060063
2-N-methoxy-4-N-(methoxymethyl)-2-N,6-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 89060063) has the molecular formula C8H15N5O2 and a molecular weight of 213.24 g/mol. Its IUPAC name is 2-N-methoxy-4-N-(methoxymethyl)-2-N,6-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-methoxy-4-N-(methoxymethyl)-2-N,6-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 89060063 |
| Molecular Formula | C8H15N5O2 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 2-N-methoxy-4-N-(methoxymethyl)-2-N,6-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | COCNc1nc(C)nc(N(C)OC)n1 |
| InChI | InChI=1S/C8H15N5O2/c1-6-10-7(9-5-14-3)12-8(11-6)13(2)15-4/h5H2,1-4H3,(H,9,10,11,12) |
| InChIKey | OQMZIUGFZWKDDE-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|