C14H23ClN6O — CID 118432233
4-N-cyclohexyl-2-N-methoxy-2-N-methyl-6-N-prop-2-ynyl-1,3,5-triazine-2,4,6-triamine;hydrochloride (PubChem CID 118432233) has the molecular formula C14H23ClN6O and a molecular weight of 326.83 g/mol. Its IUPAC name is 4-N-cyclohexyl-2-N-methoxy-2-N-methyl-6-N-prop-2-ynyl-1,3,5-triazine-2,4,6-triamine;hydrochloride.
| Compound Name | 4-N-cyclohexyl-2-N-methoxy-2-N-methyl-6-N-prop-2-ynyl-1,3,5-triazine-2,4,6-triamine;hydrochloride |
|---|---|
| PubChem CID | 118432233 |
| Molecular Formula | C14H23ClN6O |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 4-N-cyclohexyl-2-N-methoxy-2-N-methyl-6-N-prop-2-ynyl-1,3,5-triazine-2,4,6-triamine;hydrochloride |
| SMILES | C#CCNc1nc(NC2CCCCC2)nc(N(C)OC)n1.Cl |
| InChI | InChI=1S/C14H22N6O.ClH/c1-4-10-15-12-17-13(16-11-8-6-5-7-9-11)19-14(18-12)20(2)21-3;/h1,11H,5-10H2,2-3H3,(H2,15,16,17,18,19);1H |
| InChIKey | PVYMVHOKQQPNAD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|