C15H22N6O5 — CID 74767750
(E)-but-2-enedioic acid;2-N-methoxy-2-N-methyl-6-N-propyl-4-N-prop-2-ynyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 74767750) has the molecular formula C15H22N6O5 and a molecular weight of 366.38 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2-N-methoxy-2-N-methyl-6-N-propyl-4-N-prop-2-ynyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | (E)-but-2-enedioic acid;2-N-methoxy-2-N-methyl-6-N-propyl-4-N-prop-2-ynyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 74767750 |
| Molecular Formula | C15H22N6O5 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | (E)-but-2-enedioic acid;2-N-methoxy-2-N-methyl-6-N-propyl-4-N-prop-2-ynyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | C#CCNc1nc(NCCC)nc(N(C)OC)n1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C11H18N6O.C4H4O4/c1-5-7-12-9-14-10(13-8-6-2)16-11(15-9)17(3)18-4;5-3(6)1-2-4(7)8/h1H,6-8H2,2-4H3,(H2,12,13,14,15,16);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | UCCGXINCLUDROZ-WLHGVMLRSA-N |
| XLogP | 0.45 |
| TPSA | 149.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|