C12H20ClN5O — CID 118432305
4-N-methoxy-4-N-methyl-2-N-propyl-6-N-prop-2-ynylpyrimidine-2,4,6-triamine;hydrochloride (PubChem CID 118432305) has the molecular formula C12H20ClN5O and a molecular weight of 285.78 g/mol. Its IUPAC name is 4-N-methoxy-4-N-methyl-2-N-propyl-6-N-prop-2-ynylpyrimidine-2,4,6-triamine;hydrochloride.
| Compound Name | 4-N-methoxy-4-N-methyl-2-N-propyl-6-N-prop-2-ynylpyrimidine-2,4,6-triamine;hydrochloride |
|---|---|
| PubChem CID | 118432305 |
| Molecular Formula | C12H20ClN5O |
| Molecular Weight | 285.78 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 4-N-methoxy-4-N-methyl-2-N-propyl-6-N-prop-2-ynylpyrimidine-2,4,6-triamine;hydrochloride |
| SMILES | C#CCNc1cc(N(C)OC)nc(NCCC)n1.Cl |
| InChI | InChI=1S/C12H19N5O.ClH/c1-5-7-13-10-9-11(17(3)18-4)16-12(15-10)14-8-6-2;/h1,9H,6-8H2,2-4H3,(H2,13,14,15,16);1H |
| InChIKey | BPXZXSIGSVBMKZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.78 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|