C14H28N6O5S — CID 86665988
2-N-(cyclopropylmethoxy)-2-N-methyl-4-N,6-N-dipropyl-1,3,5-triazine-2,4,6-triamine;sulfuric acid (PubChem CID 86665988) has the molecular formula C14H28N6O5S and a molecular weight of 392.48 g/mol. Its IUPAC name is 2-N-(cyclopropylmethoxy)-2-N-methyl-4-N,6-N-dipropyl-1,3,5-triazine-2,4,6-triamine;sulfuric acid.
| Compound Name | 2-N-(cyclopropylmethoxy)-2-N-methyl-4-N,6-N-dipropyl-1,3,5-triazine-2,4,6-triamine;sulfuric acid |
|---|---|
| PubChem CID | 86665988 |
| Molecular Formula | C14H28N6O5S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 2-N-(cyclopropylmethoxy)-2-N-methyl-4-N,6-N-dipropyl-1,3,5-triazine-2,4,6-triamine;sulfuric acid |
| SMILES | CCCNc1nc(NCCC)nc(N(C)OCC2CC2)n1.O=S(=O)(O)O |
| InChI | InChI=1S/C14H26N6O.H2O4S/c1-4-8-15-12-17-13(16-9-5-2)19-14(18-12)20(3)21-10-11-6-7-11;1-5(2,3)4/h11H,4-10H2,1-3H3,(H2,15,16,17,18,19);(H2,1,2,3,4) |
| InChIKey | QGQKTVCGUCXXJR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 149.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|