C11H23N7O2S — CID 80775196
N-[2-[[4-(dimethylamino)-6-(propylamino)-1,3,5-triazin-2-yl]amino]ethyl]methanesulfonamide (PubChem CID 80775196) has the molecular formula C11H23N7O2S and a molecular weight of 317.42 g/mol. Its IUPAC name is N-[2-[[4-(dimethylamino)-6-(propylamino)-1,3,5-triazin-2-yl]amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[[4-(dimethylamino)-6-(propylamino)-1,3,5-triazin-2-yl]amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 80775196 |
| Molecular Formula | C11H23N7O2S |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | N-[2-[[4-(dimethylamino)-6-(propylamino)-1,3,5-triazin-2-yl]amino]ethyl]methanesulfonamide |
| SMILES | CCCNc1nc(NCCNS(C)(=O)=O)nc(N(C)C)n1 |
| InChI | InChI=1S/C11H23N7O2S/c1-5-6-12-9-15-10(17-11(16-9)18(2)3)13-7-8-14-21(4,19)20/h14H,5-8H2,1-4H3,(H2,12,13,15,16,17) |
| InChIKey | HGCGIRZQKXNZNZ-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 112.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|