C13H22ClN5O — CID 80852697
6-chloro-2-N-[2-(cyclopropylmethoxy)ethyl]-2-N-methyl-4-N-propyl-1,3,5-triazine-2,4-diamine (PubChem CID 80852697) has the molecular formula C13H22ClN5O and a molecular weight of 299.81 g/mol. Its IUPAC name is 6-chloro-2-N-[2-(cyclopropylmethoxy)ethyl]-2-N-methyl-4-N-propyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N-[2-(cyclopropylmethoxy)ethyl]-2-N-methyl-4-N-propyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80852697 |
| Molecular Formula | C13H22ClN5O |
| Molecular Weight | 299.81 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 6-chloro-2-N-[2-(cyclopropylmethoxy)ethyl]-2-N-methyl-4-N-propyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCNc1nc(Cl)nc(N(C)CCOCC2CC2)n1 |
| InChI | InChI=1S/C13H22ClN5O/c1-3-6-15-12-16-11(14)17-13(18-12)19(2)7-8-20-9-10-4-5-10/h10H,3-9H2,1-2H3,(H,15,16,17,18) |
| InChIKey | RZHFJIAUUGOWDR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.81 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|