C29H40N6O6 — CID 59302702
2-N-cyclohexyl-4-N,6-N-bis[(3,4,5-trimethoxyphenyl)methyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 59302702) has the molecular formula C29H40N6O6 and a molecular weight of 568.68 g/mol. Its IUPAC name is 2-N-cyclohexyl-4-N,6-N-bis[(3,4,5-trimethoxyphenyl)methyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-cyclohexyl-4-N,6-N-bis[(3,4,5-trimethoxyphenyl)methyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 59302702 |
| Molecular Formula | C29H40N6O6 |
| Molecular Weight | 568.68 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | 2-N-cyclohexyl-4-N,6-N-bis[(3,4,5-trimethoxyphenyl)methyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | COc1cc(CNc2nc(NCc3cc(OC)c(OC)c(OC)c3)nc(NC3CCCCC3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C29H40N6O6/c1-36-21-12-18(13-22(37-2)25(21)40-5)16-30-27-33-28(35-29(34-27)32-20-10-8-7-9-11-20)31-17-19-14-23(38-3)26(41-6)24(15-19)39-4/h12-15,20H,7-11,16-17H2,1-6H3,(H3,30,31,32,33,34,35) |
| InChIKey | RJDMWJAQZBZLKW-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 130.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.68 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |