C24H29N7O3 — CID 11123445
2-N-cyclohexyl-4-N-[(4-methoxyphenyl)methyl]-6-N-[(4-nitrophenyl)methyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 11123445) has the molecular formula C24H29N7O3 and a molecular weight of 463.54 g/mol. Its IUPAC name is 2-N-cyclohexyl-4-N-[(4-methoxyphenyl)methyl]-6-N-[(4-nitrophenyl)methyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-cyclohexyl-4-N-[(4-methoxyphenyl)methyl]-6-N-[(4-nitrophenyl)methyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 11123445 |
| Molecular Formula | C24H29N7O3 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | 2-N-cyclohexyl-4-N-[(4-methoxyphenyl)methyl]-6-N-[(4-nitrophenyl)methyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | COc1ccc(CNc2nc(NCc3ccc([N+](=O)[O-])cc3)nc(NC3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C24H29N7O3/c1-34-21-13-9-18(10-14-21)16-26-23-28-22(25-15-17-7-11-20(12-8-17)31(32)33)29-24(30-23)27-19-5-3-2-4-6-19/h7-14,19H,2-6,15-16H2,1H3,(H3,25,26,27,28,29,30) |
| InChIKey | RZHXOGZKQHSXKU-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 127.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|