C27H36N6O4 — CID 23900803
2-N-cyclohexyl-4-N-[(2,3-dimethoxyphenyl)methyl]-6-N-[(3,4-dimethoxyphenyl)methyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 23900803) has the molecular formula C27H36N6O4 and a molecular weight of 508.62 g/mol. Its IUPAC name is 2-N-cyclohexyl-4-N-[(2,3-dimethoxyphenyl)methyl]-6-N-[(3,4-dimethoxyphenyl)methyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-cyclohexyl-4-N-[(2,3-dimethoxyphenyl)methyl]-6-N-[(3,4-dimethoxyphenyl)methyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 23900803 |
| Molecular Formula | C27H36N6O4 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | 2-N-cyclohexyl-4-N-[(2,3-dimethoxyphenyl)methyl]-6-N-[(3,4-dimethoxyphenyl)methyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | COc1ccc(CNc2nc(NCc3cccc(OC)c3OC)nc(NC3CCCCC3)n2)cc1OC |
| InChI | InChI=1S/C27H36N6O4/c1-34-21-14-13-18(15-23(21)36-3)16-28-25-31-26(33-27(32-25)30-20-10-6-5-7-11-20)29-17-19-9-8-12-22(35-2)24(19)37-4/h8-9,12-15,20H,5-7,10-11,16-17H2,1-4H3,(H3,28,29,30,31,32,33) |
| InChIKey | ZXJJJLCHAOXSNF-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |