C10H19N5S — CID 151492954
N-tert-butyl-N-[4-(ethylamino)-6-methyl-1,3,5-triazin-2-yl]thiohydroxylamine (PubChem CID 151492954) has the molecular formula C10H19N5S and a molecular weight of 241.36 g/mol. Its IUPAC name is N-tert-butyl-N-[4-(ethylamino)-6-methyl-1,3,5-triazin-2-yl]thiohydroxylamine.
| Compound Name | N-tert-butyl-N-[4-(ethylamino)-6-methyl-1,3,5-triazin-2-yl]thiohydroxylamine |
|---|---|
| PubChem CID | 151492954 |
| Molecular Formula | C10H19N5S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | N-tert-butyl-N-[4-(ethylamino)-6-methyl-1,3,5-triazin-2-yl]thiohydroxylamine |
| SMILES | CCNc1nc(C)nc(N(S)C(C)(C)C)n1 |
| InChI | InChI=1S/C10H19N5S/c1-6-11-8-12-7(2)13-9(14-8)15(16)10(3,4)5/h16H,6H2,1-5H3,(H,11,12,13,14) |
| InChIKey | POVPBKAZGIRTLD-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|