C8H14N4 — CID 21337127
N,4-diethyl-6-methyl-1,3,5-triazin-2-amine (PubChem CID 21337127) has the molecular formula C8H14N4 and a molecular weight of 166.23 g/mol. Its IUPAC name is N,4-diethyl-6-methyl-1,3,5-triazin-2-amine.
| Compound Name | N,4-diethyl-6-methyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 21337127 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | N,4-diethyl-6-methyl-1,3,5-triazin-2-amine |
| SMILES | CCNc1nc(C)nc(CC)n1 |
| InChI | InChI=1S/C8H14N4/c1-4-7-10-6(3)11-8(12-7)9-5-2/h4-5H2,1-3H3,(H,9,10,11,12) |
| InChIKey | YKGQBHGQJUFMNS-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |