C10H18N4O — CID 58502729
2-[(4-butyl-6-methyl-1,3,5-triazin-2-yl)amino]ethanol (PubChem CID 58502729) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-[(4-butyl-6-methyl-1,3,5-triazin-2-yl)amino]ethanol.
| Compound Name | 2-[(4-butyl-6-methyl-1,3,5-triazin-2-yl)amino]ethanol |
|---|---|
| PubChem CID | 58502729 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 2-[(4-butyl-6-methyl-1,3,5-triazin-2-yl)amino]ethanol |
| SMILES | CCCCc1nc(C)nc(NCCO)n1 |
| InChI | InChI=1S/C10H18N4O/c1-3-4-5-9-12-8(2)13-10(14-9)11-6-7-15/h15H,3-7H2,1-2H3,(H,11,12,13,14) |
| InChIKey | HKFBEBCGVBVJAQ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |