C10H17N3 — CID 15211759
2,4-dimethyl-6-pentyl-1,3,5-triazine (PubChem CID 15211759) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 2,4-dimethyl-6-pentyl-1,3,5-triazine.
| Compound Name | 2,4-dimethyl-6-pentyl-1,3,5-triazine |
|---|---|
| PubChem CID | 15211759 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 2,4-dimethyl-6-pentyl-1,3,5-triazine |
| SMILES | CCCCCc1nc(C)nc(C)n1 |
| InChI | InChI=1S/C10H17N3/c1-4-5-6-7-10-12-8(2)11-9(3)13-10/h4-7H2,1-3H3 |
| InChIKey | XCPVNXXXQNQWGY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|