C10H15Cl2N3 — CID 69095431
2,4-bis(chloromethyl)-6-pentyl-1,3,5-triazine (PubChem CID 69095431) has the molecular formula C10H15Cl2N3 and a molecular weight of 248.16 g/mol. Its IUPAC name is 2,4-bis(chloromethyl)-6-pentyl-1,3,5-triazine.
| Compound Name | 2,4-bis(chloromethyl)-6-pentyl-1,3,5-triazine |
|---|---|
| PubChem CID | 69095431 |
| Molecular Formula | C10H15Cl2N3 |
| Molecular Weight | 248.16 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 2,4-bis(chloromethyl)-6-pentyl-1,3,5-triazine |
| SMILES | CCCCCc1nc(CCl)nc(CCl)n1 |
| InChI | InChI=1S/C10H15Cl2N3/c1-2-3-4-5-8-13-9(6-11)15-10(7-12)14-8/h2-7H2,1H3 |
| InChIKey | FUEHWCXZHGQWDZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.16 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|