C9H12Cl2N2O2S — CID 174611336
3-pentyl-2,4-diazabicyclo[3.1.0]hexa-1(6),2,4-triene;sulfuryl dichloride (PubChem CID 174611336) has the molecular formula C9H12Cl2N2O2S and a molecular weight of 283.18 g/mol. Its IUPAC name is 3-pentyl-2,4-diazabicyclo[3.1.0]hexa-1(6),2,4-triene;sulfuryl dichloride.
| Compound Name | 3-pentyl-2,4-diazabicyclo[3.1.0]hexa-1(6),2,4-triene;sulfuryl dichloride |
|---|---|
| PubChem CID | 174611336 |
| Molecular Formula | C9H12Cl2N2O2S |
| Molecular Weight | 283.18 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | 3-pentyl-2,4-diazabicyclo[3.1.0]hexa-1(6),2,4-triene;sulfuryl dichloride |
| SMILES | CCCCCc1nc2cc-2n1.O=S(=O)(Cl)Cl |
| InChI | InChI=1S/C9H12N2.Cl2O2S/c1-2-3-4-5-9-10-7-6-8(7)11-9;1-5(2,3)4/h6H,2-5H2,1H3; |
| InChIKey | PRWUXPCTJSRKLI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.18 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|