C24H41N5 — CID 157427789
2-butyl-4-methyl-6-pentyl-1,3,5-triazine;4-ethyl-5,6-dimethyl-2-propylpyrimidine (PubChem CID 157427789) has the molecular formula C24H41N5 and a molecular weight of 399.63 g/mol. Its IUPAC name is 2-butyl-4-methyl-6-pentyl-1,3,5-triazine;4-ethyl-5,6-dimethyl-2-propylpyrimidine.
| Compound Name | 2-butyl-4-methyl-6-pentyl-1,3,5-triazine;4-ethyl-5,6-dimethyl-2-propylpyrimidine |
|---|---|
| PubChem CID | 157427789 |
| Molecular Formula | C24H41N5 |
| Molecular Weight | 399.63 g/mol |
| Exact Mass | 399.34 |
| IUPAC Name | 2-butyl-4-methyl-6-pentyl-1,3,5-triazine;4-ethyl-5,6-dimethyl-2-propylpyrimidine |
| SMILES | CCCCCc1nc(C)nc(CCCC)n1.CCCc1nc(C)c(C)c(CC)n1 |
| InChI | InChI=1S/C13H23N3.C11H18N2/c1-4-6-8-10-13-15-11(3)14-12(16-13)9-7-5-2;1-5-7-11-12-9(4)8(3)10(6-2)13-11/h4-10H2,1-3H3;5-7H2,1-4H3 |
| InChIKey | BQDYVLZWAYFHHU-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.63 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|