C20H36N2 — CID 66935521
2-methyl-4,5,6-tripentylpyrimidine (PubChem CID 66935521) has the molecular formula C20H36N2 and a molecular weight of 304.52 g/mol. Its IUPAC name is 2-methyl-4,5,6-tripentylpyrimidine.
| Compound Name | 2-methyl-4,5,6-tripentylpyrimidine |
|---|---|
| PubChem CID | 66935521 |
| Molecular Formula | C20H36N2 |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.29 |
| IUPAC Name | 2-methyl-4,5,6-tripentylpyrimidine |
| SMILES | CCCCCc1nc(C)nc(CCCCC)c1CCCCC |
| InChI | InChI=1S/C20H36N2/c1-5-8-11-14-18-19(15-12-9-6-2)21-17(4)22-20(18)16-13-10-7-3/h5-16H2,1-4H3 |
| InChIKey | PUVJDFPIAMYUAL-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|