About 2-methyl-4,5,6-tripentylpyrimidine
2-methyl-4,5,6-tripentylpyrimidine (PubChem CID 66935521) has the molecular formula C20H36N2
and a molecular weight of 304.52 g/mol. Its IUPAC name is 2-methyl-4,5,6-tripentylpyrimidine.
Molecular Properties
| Compound Name | 2-methyl-4,5,6-tripentylpyrimidine |
| PubChem CID | 66935521 |
| Molecular Formula | C20H36N2 |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.29 |
| IUPAC Name | 2-methyl-4,5,6-tripentylpyrimidine |
| SMILES | CCCCCc1nc(C)nc(CCCCC)c1CCCCC |
| InChI | InChI=1S/C20H36N2/c1-5-8-11-14-18-19(15-12-9-6-2)21-17(4)22-20(18)16-13-10-7-3/h5-16H2,1-4H3 |
| InChIKey | PUVJDFPIAMYUAL-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-4,5,6-tripentylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4,5,6-tripentylpyrimidine?
The IUPAC name of 2-methyl-4,5,6-tripentylpyrimidine (CID 66935521) is 2-methyl-4,5,6-tripentylpyrimidine.
What is the SMILES notation for 2-methyl-4,5,6-tripentylpyrimidine?
The canonical SMILES for 2-methyl-4,5,6-tripentylpyrimidine is CCCCCc1nc(C)nc(CCCCC)c1CCCCC.
What is the InChIKey of 2-methyl-4,5,6-tripentylpyrimidine?
The InChIKey is PUVJDFPIAMYUAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H36N2/c1-5-8-11-14-18-19(15-12-9-6-2)21-17(4)22-20(18)16-13-10-7-3/h5-16H2,1-4H3.
What are the key properties of 2-methyl-4,5,6-tripentylpyrimidine?
2-methyl-4,5,6-tripentylpyrimidine has a molecular weight of 304.52 g/mol, XLogP of 5.98, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4,5,6-tripentylpyrimidine is sourced from PubChem (CID 66935521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).