C24H38N12 — CID 159580241
N'-(4,6-dimethyl-1,3,5-triazin-2-yl)-N-[2-[(4,6-dimethyl-1,3,5-triazin-2-yl)-[4-(4,6-dimethyl-1,3,5-triazin-2-yl)butyl]amino]ethyl]propane-1,3-diamine (PubChem CID 159580241) has the molecular formula C24H38N12 and a molecular weight of 494.65 g/mol. Its IUPAC name is N'-(4,6-dimethyl-1,3,5-triazin-2-yl)-N-[2-[(4,6-dimethyl-1,3,5-triazin-2-yl)-[4-(4,6-dimethyl-1,3,5-triazin-2-yl)butyl]amino]ethyl]propane-1,3-diamine.
| Compound Name | N'-(4,6-dimethyl-1,3,5-triazin-2-yl)-N-[2-[(4,6-dimethyl-1,3,5-triazin-2-yl)-[4-(4,6-dimethyl-1,3,5-triazin-2-yl)butyl]amino]ethyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 159580241 |
| Molecular Formula | C24H38N12 |
| Molecular Weight | 494.65 g/mol |
| Exact Mass | 494.33 |
| IUPAC Name | N'-(4,6-dimethyl-1,3,5-triazin-2-yl)-N-[2-[(4,6-dimethyl-1,3,5-triazin-2-yl)-[4-(4,6-dimethyl-1,3,5-triazin-2-yl)butyl]amino]ethyl]propane-1,3-diamine |
| SMILES | Cc1nc(C)nc(CCCCN(CCNCCCNc2nc(C)nc(C)n2)c2nc(C)nc(C)n2)n1 |
| InChI | InChI=1S/C24H38N12/c1-16-27-17(2)31-22(30-16)10-7-8-14-36(24-34-20(5)29-21(6)35-24)15-13-25-11-9-12-26-23-32-18(3)28-19(4)33-23/h25H,7-15H2,1-6H3,(H,26,28,32,33) |
| InChIKey | UZLSJBCQZPNEHF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 143.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.65 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|