C17H35N7O3 — CID 67122999
2-[[4-[bis(2-hydroxyethyl)amino]-6-(2,2-dibutylhydrazinyl)-1,3,5-triazin-2-yl]amino]ethanol (PubChem CID 67122999) has the molecular formula C17H35N7O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is 2-[[4-[bis(2-hydroxyethyl)amino]-6-(2,2-dibutylhydrazinyl)-1,3,5-triazin-2-yl]amino]ethanol.
| Compound Name | 2-[[4-[bis(2-hydroxyethyl)amino]-6-(2,2-dibutylhydrazinyl)-1,3,5-triazin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 67122999 |
| Molecular Formula | C17H35N7O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.28 |
| IUPAC Name | 2-[[4-[bis(2-hydroxyethyl)amino]-6-(2,2-dibutylhydrazinyl)-1,3,5-triazin-2-yl]amino]ethanol |
| SMILES | CCCCN(CCCC)Nc1nc(NCCO)nc(N(CCO)CCO)n1 |
| InChI | InChI=1S/C17H35N7O3/c1-3-5-8-24(9-6-4-2)22-16-19-15(18-7-12-25)20-17(21-16)23(10-13-26)11-14-27/h25-27H,3-14H2,1-2H3,(H2,18,19,20,21,22) |
| InChIKey | XHSZZUFUVWUVJK-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 129.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|