C42H75N21 — CID 118603009
2-N-[4,6-bis[[4,6-bis(propylamino)-1,3,5-triazin-2-yl]-butylamino]-1,3,5-triazin-2-yl]-2-N-butyl-4-N,6-N-dipropyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 118603009) has the molecular formula C42H75N21 and a molecular weight of 874.21 g/mol. Its IUPAC name is 2-N-[4,6-bis[[4,6-bis(propylamino)-1,3,5-triazin-2-yl]-butylamino]-1,3,5-triazin-2-yl]-2-N-butyl-4-N,6-N-dipropyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[4,6-bis[[4,6-bis(propylamino)-1,3,5-triazin-2-yl]-butylamino]-1,3,5-triazin-2-yl]-2-N-butyl-4-N,6-N-dipropyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 118603009 |
| Molecular Formula | C42H75N21 |
| Molecular Weight | 874.21 g/mol |
| Exact Mass | 873.65 |
| IUPAC Name | 2-N-[4,6-bis[[4,6-bis(propylamino)-1,3,5-triazin-2-yl]-butylamino]-1,3,5-triazin-2-yl]-2-N-butyl-4-N,6-N-dipropyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCN(c1nc(NCCC)nc(NCCC)n1)c1nc(N(CCCC)c2nc(NCCC)nc(NCCC)n2)nc(N(CCCC)c2nc(NCCC)nc(NCCC)n2)n1 |
| InChI | InChI=1S/C42H75N21/c1-10-19-28-61(37-52-31(43-22-13-4)49-32(53-37)44-23-14-5)40-58-41(62(29-20-11-2)38-54-33(45-24-15-6)50-34(55-38)46-25-16-7)60-42(59-40)63(30-21-12-3)39-56-35(47-26-17-8)51-36(57-39)48-27-18-9/h10-30H2,1-9H3,(H2,43,44,49,52,53)(H2,45,46,50,54,55)(H2,47,48,51,56,57) |
| InChIKey | AJBHPPAYPMDBIO-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 236.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 63 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.21 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 21 |