C30H61N7 — CID 155679051
6-N-(3-aminopropyl)-4-N-(2-ethylhexyl)-2-N,2-N-dioctyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 155679051) has the molecular formula C30H61N7 and a molecular weight of 519.87 g/mol. Its IUPAC name is 6-N-(3-aminopropyl)-4-N-(2-ethylhexyl)-2-N,2-N-dioctyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-(3-aminopropyl)-4-N-(2-ethylhexyl)-2-N,2-N-dioctyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 155679051 |
| Molecular Formula | C30H61N7 |
| Molecular Weight | 519.87 g/mol |
| Exact Mass | 519.50 |
| IUPAC Name | 6-N-(3-aminopropyl)-4-N-(2-ethylhexyl)-2-N,2-N-dioctyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCCCCCN(CCCCCCCC)c1nc(NCCCN)nc(NCC(CC)CCCC)n1 |
| InChI | InChI=1S/C30H61N7/c1-5-9-12-14-16-18-24-37(25-19-17-15-13-10-6-2)30-35-28(32-23-20-22-31)34-29(36-30)33-26-27(8-4)21-11-7-3/h27H,5-26,31H2,1-4H3,(H2,32,33,34,35,36) |
| InChIKey | QKWWEIVTCCPXEL-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.87 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|