C15H19N5O4 — CID 29128239
methyl 4-[[4-(dimethylamino)-6-(methoxymethylamino)-1,3,5-triazin-2-yl]oxy]benzoate (PubChem CID 29128239) has the molecular formula C15H19N5O4 and a molecular weight of 333.35 g/mol. Its IUPAC name is methyl 4-[[4-(dimethylamino)-6-(methoxymethylamino)-1,3,5-triazin-2-yl]oxy]benzoate.
| Compound Name | methyl 4-[[4-(dimethylamino)-6-(methoxymethylamino)-1,3,5-triazin-2-yl]oxy]benzoate |
|---|---|
| PubChem CID | 29128239 |
| Molecular Formula | C15H19N5O4 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | methyl 4-[[4-(dimethylamino)-6-(methoxymethylamino)-1,3,5-triazin-2-yl]oxy]benzoate |
| SMILES | COCNc1nc(Oc2ccc(C(=O)OC)cc2)nc(N(C)C)n1 |
| InChI | InChI=1S/C15H19N5O4/c1-20(2)14-17-13(16-9-22-3)18-15(19-14)24-11-7-5-10(6-8-11)12(21)23-4/h5-8H,9H2,1-4H3,(H,16,17,18,19) |
| InChIKey | XGGPEHRXUMEGOP-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|