C14H19N7O2 — CID 23820823
4-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]oxy]benzohydrazide (PubChem CID 23820823) has the molecular formula C14H19N7O2 and a molecular weight of 317.35 g/mol. Its IUPAC name is 4-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]oxy]benzohydrazide.
| Compound Name | 4-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]oxy]benzohydrazide |
|---|---|
| PubChem CID | 23820823 |
| Molecular Formula | C14H19N7O2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 4-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]oxy]benzohydrazide |
| SMILES | CN(C)c1nc(Oc2ccc(C(=O)NN)cc2)nc(N(C)C)n1 |
| InChI | InChI=1S/C14H19N7O2/c1-20(2)12-16-13(21(3)4)18-14(17-12)23-10-7-5-9(6-8-10)11(22)19-15/h5-8H,15H2,1-4H3,(H,19,22) |
| InChIKey | WERGFJQMIULTTE-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|