C11H22N6O — CID 80766275
2-N,2-N-diethyl-4-N-(2-methoxyethyl)-6-N-methyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 80766275) has the molecular formula C11H22N6O and a molecular weight of 254.34 g/mol. Its IUPAC name is 2-N,2-N-diethyl-4-N-(2-methoxyethyl)-6-N-methyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N-diethyl-4-N-(2-methoxyethyl)-6-N-methyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80766275 |
| Molecular Formula | C11H22N6O |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 2-N,2-N-diethyl-4-N-(2-methoxyethyl)-6-N-methyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN(CC)c1nc(NC)nc(NCCOC)n1 |
| InChI | InChI=1S/C11H22N6O/c1-5-17(6-2)11-15-9(12-3)14-10(16-11)13-7-8-18-4/h5-8H2,1-4H3,(H2,12,13,14,15,16) |
| InChIKey | VDCSLJNESALHHU-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|