C10H20N6O — CID 80793588
4-N-(2-ethoxyethyl)-2-N,2-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 80793588) has the molecular formula C10H20N6O and a molecular weight of 240.31 g/mol. Its IUPAC name is 4-N-(2-ethoxyethyl)-2-N,2-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-(2-ethoxyethyl)-2-N,2-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80793588 |
| Molecular Formula | C10H20N6O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 4-N-(2-ethoxyethyl)-2-N,2-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCOCCNc1nc(NC)nc(N(C)C)n1 |
| InChI | InChI=1S/C10H20N6O/c1-5-17-7-6-12-9-13-8(11-2)14-10(15-9)16(3)4/h5-7H2,1-4H3,(H2,11,12,13,14,15) |
| InChIKey | XBAIVUDPNNMXHF-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|