C15H30N6 — CID 107818936
2-N,2-N,6-N-trimethyl-4-N-(7-methyloctyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 107818936) has the molecular formula C15H30N6 and a molecular weight of 294.45 g/mol. Its IUPAC name is 2-N,2-N,6-N-trimethyl-4-N-(7-methyloctyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N,6-N-trimethyl-4-N-(7-methyloctyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 107818936 |
| Molecular Formula | C15H30N6 |
| Molecular Weight | 294.45 g/mol |
| Exact Mass | 294.25 |
| IUPAC Name | 2-N,2-N,6-N-trimethyl-4-N-(7-methyloctyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1nc(NCCCCCCC(C)C)nc(N(C)C)n1 |
| InChI | InChI=1S/C15H30N6/c1-12(2)10-8-6-7-9-11-17-14-18-13(16-3)19-15(20-14)21(4)5/h12H,6-11H2,1-5H3,(H2,16,17,18,19,20) |
| InChIKey | VQHVKGRCSYAHHL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|